C46H24B5N3O — CID 174073588
CID 174073588 (PubChem CID 174073588) has the molecular formula C46H24B5N3O and a molecular weight of 688.78 g/mol.
| Compound Name | CID 174073588 |
|---|---|
| PubChem CID | 174073588 |
| Molecular Formula | C46H24B5N3O |
| Molecular Weight | 688.78 g/mol |
| Exact Mass | 689.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccccc3)cc(-c3cccc4c3oc3ccc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)cc34)n2)c([B])c1[B] |
| InChI | InChI=1S/C46H24B5N3O/c47-40-39(41(48)43(50)44(51)42(40)49)46-52-34(25-10-3-1-4-11-25)24-35(53-46)31-16-9-15-30-33-23-27(19-21-38(33)55-45(30)31)26-18-20-37-32(22-26)29-14-7-8-17-36(29)54(37)28-12-5-2-6-13-28/h1-24H |
| InChIKey | LLZBPLBQRHZXDA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|