C20H20F3N7 — CID 174076556
3-[[3-amino-2-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]prop-2-enylidene]amino]-3-cyclopentylpropanenitrile (PubChem CID 174076556) has the molecular formula C20H20F3N7 and a molecular weight of 415.42 g/mol. Its IUPAC name is 3-[[3-amino-2-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]prop-2-enylidene]amino]-3-cyclopentylpropanenitrile.
| Compound Name | 3-[[3-amino-2-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]prop-2-enylidene]amino]-3-cyclopentylpropanenitrile |
|---|---|
| PubChem CID | 174076556 |
| Molecular Formula | C20H20F3N7 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 3-[[3-amino-2-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]prop-2-enylidene]amino]-3-cyclopentylpropanenitrile |
| SMILES | N#CCC(/N=C/C(=CN)n1c(C(F)(F)F)nc2cnc3[nH]ccc3c21)C1CCCC1 |
| InChI | InChI=1S/C20H20F3N7/c21-20(22,23)19-29-16-11-28-18-14(6-8-26-18)17(16)30(19)13(9-25)10-27-15(5-7-24)12-3-1-2-4-12/h6,8-12,15H,1-5,25H2,(H,26,28)/b13-9?,27-10+ |
| InChIKey | PIKMXFXBHWLDCI-CTXIWVDFSA-N |
| XLogP | 4.23 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|