C36H31IN4 — CID 174077561
4-[4-[5-[(3R,5R,7S)-3-iodo-7-methyl-1-bicyclo[3.3.1]nonanyl]naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 174077561) has the molecular formula C36H31IN4 and a molecular weight of 646.58 g/mol. Its IUPAC name is 4-[4-[5-[(3R,5R,7S)-3-iodo-7-methyl-1-bicyclo[3.3.1]nonanyl]naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-[5-[(3R,5R,7S)-3-iodo-7-methyl-1-bicyclo[3.3.1]nonanyl]naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 174077561 |
| Molecular Formula | C36H31IN4 |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | 4-[4-[5-[(3R,5R,7S)-3-iodo-7-methyl-1-bicyclo[3.3.1]nonanyl]naphthalen-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C[C@H]1C[C@H]2C[C@@H](I)CC(c3cccc4cc(-c5nc(-c6ccccc6)nc(-c6ccc(C#N)cc6)n5)ccc34)(C1)C2 |
| InChI | InChI=1S/C36H31IN4/c1-23-16-25-17-30(37)21-36(19-23,20-25)32-9-5-8-28-18-29(14-15-31(28)32)35-40-33(26-6-3-2-4-7-26)39-34(41-35)27-12-10-24(22-38)11-13-27/h2-15,18,23,25,30H,16-17,19-21H2,1H3/t23-,25-,30+,36?/m0/s1 |
| InChIKey | NBCDLAKGXGPLOG-YOSBVXNNSA-N |
| XLogP | 9.17 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|