C19H21BN2O2 — CID 174083145
[(3Z,5E)-5-[3-[N-ethenyl-C-(ethenyliminomethyl)carbonimidoyl]phenyl]hepta-1,3,5-trien-3-yl]boronic acid (PubChem CID 174083145) has the molecular formula C19H21BN2O2 and a molecular weight of 320.20 g/mol. Its IUPAC name is [(3Z,5E)-5-[3-[N-ethenyl-C-(ethenyliminomethyl)carbonimidoyl]phenyl]hepta-1,3,5-trien-3-yl]boronic acid.
| Compound Name | [(3Z,5E)-5-[3-[N-ethenyl-C-(ethenyliminomethyl)carbonimidoyl]phenyl]hepta-1,3,5-trien-3-yl]boronic acid |
|---|---|
| PubChem CID | 174083145 |
| Molecular Formula | C19H21BN2O2 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [(3Z,5E)-5-[3-[N-ethenyl-C-(ethenyliminomethyl)carbonimidoyl]phenyl]hepta-1,3,5-trien-3-yl]boronic acid |
| SMILES | C=C/N=C(\C=N\C=C)c1cccc(C(/C=C(\C=C)B(O)O)=C/C)c1 |
| InChI | InChI=1S/C19H21BN2O2/c1-5-15(13-18(6-2)20(23)24)16-10-9-11-17(12-16)19(22-8-4)14-21-7-3/h5-14,23-24H,2-4H2,1H3/b15-5+,18-13+,21-14+,22-19+ |
| InChIKey | IOFIHWBYSVSMTB-RQHWWMAYSA-N |
| XLogP | 3.36 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|