C26H34F2N6O3Si — CID 174087748
7-[cyclopropyl-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]amino]-2-(2-trimethylsilylethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 174087748) has the molecular formula C26H34F2N6O3Si and a molecular weight of 544.68 g/mol. Its IUPAC name is 7-[cyclopropyl-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]amino]-2-(2-trimethylsilylethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 7-[cyclopropyl-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]amino]-2-(2-trimethylsilylethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 174087748 |
| Molecular Formula | C26H34F2N6O3Si |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 7-[cyclopropyl-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]amino]-2-(2-trimethylsilylethoxymethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C[Si](C)(C)CCOCn1nc2cc(N(c3ccc(C(=O)N4CCC(F)(F)CC4)cn3)C3CC3)ccn2c1=O |
| InChI | InChI=1S/C26H34F2N6O3Si/c1-38(2,3)15-14-37-18-33-25(36)32-11-8-21(16-23(32)30-33)34(20-5-6-20)22-7-4-19(17-29-22)24(35)31-12-9-26(27,28)10-13-31/h4,7-8,11,16-17,20H,5-6,9-10,12-15,18H2,1-3H3 |
| InChIKey | HGDBAUXNIZVARG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|