C15H23BNO2 — CID 174088623
CID 174088623 (PubChem CID 174088623) has the molecular formula C15H23BNO2 and a molecular weight of 260.17 g/mol.
| Compound Name | CID 174088623 |
|---|---|
| PubChem CID | 174088623 |
| Molecular Formula | C15H23BNO2 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cccc2c1CCNC2 |
| InChI | InChI=1S/C15H23BNO2/c1-14(2,18)15(3,4)19-16-13-7-5-6-11-10-17-9-8-12(11)13/h5-7,17-18H,8-10H2,1-4H3 |
| InChIKey | UMDWPBKQFQKOFB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|