C21H28N3O4SSi — CID 174090132
CID 174090132 (PubChem CID 174090132) has the molecular formula C21H28N3O4SSi and a molecular weight of 446.63 g/mol.
| Compound Name | CID 174090132 |
|---|---|
| PubChem CID | 174090132 |
| Molecular Formula | C21H28N3O4SSi |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N[C@]1([Si])COC(C)(C)C[C@@H]1Nc1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C21H28N3O4SSi/c1-19(2,3)28-18(25)24-21(30)11-27-20(4,5)10-15(21)22-17-23-16-12-8-9-26-13(12)6-7-14(16)29-17/h6-7,15H,8-11H2,1-5H3,(H,22,23)(H,24,25)/t15-,21-/m0/s1 |
| InChIKey | LZHHZDBSMXYAKH-BTYIYWSLSA-N |
| XLogP | 3.60 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|