C18H20BrF3N2S — CID 174091244
1-(6-bromo-1-cyclobutyl-5-fluoroindol-3-yl)-N-tert-butylsulfanyl-2,2-difluoroethanimine (PubChem CID 174091244) has the molecular formula C18H20BrF3N2S and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-(6-bromo-1-cyclobutyl-5-fluoroindol-3-yl)-N-tert-butylsulfanyl-2,2-difluoroethanimine.
| Compound Name | 1-(6-bromo-1-cyclobutyl-5-fluoroindol-3-yl)-N-tert-butylsulfanyl-2,2-difluoroethanimine |
|---|---|
| PubChem CID | 174091244 |
| Molecular Formula | C18H20BrF3N2S |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-(6-bromo-1-cyclobutyl-5-fluoroindol-3-yl)-N-tert-butylsulfanyl-2,2-difluoroethanimine |
| SMILES | CC(C)(C)SN=C(c1cn(C2CCC2)c2cc(Br)c(F)cc12)C(F)F |
| InChI | InChI=1S/C18H20BrF3N2S/c1-18(2,3)25-23-16(17(21)22)12-9-24(10-5-4-6-10)15-8-13(19)14(20)7-11(12)15/h7-10,17H,4-6H2,1-3H3 |
| InChIKey | CUBJFWGQPBCFSX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|