C17H19ClF3N3OS — CID 174059869
tert-butyl-[[1-(6-chloro-1-cyclobutyl-5-fluoropyrrolo[2,3-b]pyridin-3-yl)-2,2-difluoroethylidene]amino]-oxidosulfanium (PubChem CID 174059869) has the molecular formula C17H19ClF3N3OS and a molecular weight of 405.87 g/mol. Its IUPAC name is tert-butyl-[[1-(6-chloro-1-cyclobutyl-5-fluoropyrrolo[2,3-b]pyridin-3-yl)-2,2-difluoroethylidene]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-(6-chloro-1-cyclobutyl-5-fluoropyrrolo[2,3-b]pyridin-3-yl)-2,2-difluoroethylidene]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174059869 |
| Molecular Formula | C17H19ClF3N3OS |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | tert-butyl-[[1-(6-chloro-1-cyclobutyl-5-fluoropyrrolo[2,3-b]pyridin-3-yl)-2,2-difluoroethylidene]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N=C(c1cn(C2CCC2)c2nc(Cl)c(F)cc12)C(F)F |
| InChI | InChI=1S/C17H19ClF3N3OS/c1-17(2,3)26(25)23-13(15(20)21)11-8-24(9-5-4-6-9)16-10(11)7-12(19)14(18)22-16/h7-9,15H,4-6H2,1-3H3 |
| InChIKey | LYKWXVPJVMKPHK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|