C21H24ClFN2O3 — CID 46947388
cyclohexyl 7-chloro-1-cyclohexyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 46947388) has the molecular formula C21H24ClFN2O3 and a molecular weight of 406.89 g/mol. Its IUPAC name is cyclohexyl 7-chloro-1-cyclohexyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | cyclohexyl 7-chloro-1-cyclohexyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 46947388 |
| Molecular Formula | C21H24ClFN2O3 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | cyclohexyl 7-chloro-1-cyclohexyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | O=C(OC1CCCCC1)c1cn(C2CCCCC2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C21H24ClFN2O3/c22-19-17(23)11-15-18(26)16(21(27)28-14-9-5-2-6-10-14)12-25(20(15)24-19)13-7-3-1-4-8-13/h11-14H,1-10H2 |
| InChIKey | QZXROQOTLIJFFD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|