C18H23ClF3N3OS — CID 175920986
tert-butyl-[[1-[6-chloro-1-(2,2-dimethylpropyl)-5-fluoropyrrolo[2,3-b]pyridin-3-yl]-2,2-difluoroethylidene]amino]-oxidosulfanium (PubChem CID 175920986) has the molecular formula C18H23ClF3N3OS and a molecular weight of 421.92 g/mol. Its IUPAC name is tert-butyl-[[1-[6-chloro-1-(2,2-dimethylpropyl)-5-fluoropyrrolo[2,3-b]pyridin-3-yl]-2,2-difluoroethylidene]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-[6-chloro-1-(2,2-dimethylpropyl)-5-fluoropyrrolo[2,3-b]pyridin-3-yl]-2,2-difluoroethylidene]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175920986 |
| Molecular Formula | C18H23ClF3N3OS |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | tert-butyl-[[1-[6-chloro-1-(2,2-dimethylpropyl)-5-fluoropyrrolo[2,3-b]pyridin-3-yl]-2,2-difluoroethylidene]amino]-oxidosulfanium |
| SMILES | CC(C)(C)Cn1cc(C(=N[S+]([O-])C(C)(C)C)C(F)F)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C18H23ClF3N3OS/c1-17(2,3)9-25-8-11(10-7-12(20)14(19)23-16(10)25)13(15(21)22)24-27(26)18(4,5)6/h7-8,15H,9H2,1-6H3 |
| InChIKey | AFNRUZJOWVYUTO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|