C20H23F2N4O3S+ — CID 174100386
2-[4-[[5-(difluoromethoxy)-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium (PubChem CID 174100386) has the molecular formula C20H23F2N4O3S+ and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[4-[[5-(difluoromethoxy)-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium.
| Compound Name | 2-[4-[[5-(difluoromethoxy)-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium |
|---|---|
| PubChem CID | 174100386 |
| Molecular Formula | C20H23F2N4O3S+ |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[4-[[5-(difluoromethoxy)-1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium |
| SMILES | CN1C(=O)C2(CCN(Cc3cnn(CC[S+]=O)c3)CC2)c2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C20H23F2N4O3S/c1-24-17-3-2-15(29-19(21)22)10-16(17)20(18(24)27)4-6-25(7-5-20)12-14-11-23-26(13-14)8-9-30-28/h2-3,10-11,13,19H,4-9,12H2,1H3/q+1 |
| InChIKey | YUJOUTDWWSBGDF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|