C20H22F3N4O2S+ — CID 174100380
2-[4-[[1-methyl-2-oxo-5-(trifluoromethyl)spiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium (PubChem CID 174100380) has the molecular formula C20H22F3N4O2S+ and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-[4-[[1-methyl-2-oxo-5-(trifluoromethyl)spiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium.
| Compound Name | 2-[4-[[1-methyl-2-oxo-5-(trifluoromethyl)spiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium |
|---|---|
| PubChem CID | 174100380 |
| Molecular Formula | C20H22F3N4O2S+ |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[4-[[1-methyl-2-oxo-5-(trifluoromethyl)spiro[indole-3,4'-piperidine]-1'-yl]methyl]pyrazol-1-yl]ethyl-oxosulfanium |
| SMILES | CN1C(=O)C2(CCN(Cc3cnn(CC[S+]=O)c3)CC2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H22F3N4O2S/c1-25-17-3-2-15(20(21,22)23)10-16(17)19(18(25)28)4-6-26(7-5-19)12-14-11-24-27(13-14)8-9-30-29/h2-3,10-11,13H,4-9,12H2,1H3/q+1 |
| InChIKey | IGVRJZXZWAPALT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|