C14H16F4N2O3S — CID 174103365
tert-butyl-[[(1R)-1-[2-fluoro-5-nitro-3-(trifluoromethyl)phenyl]prop-2-enyl]amino]-oxidosulfanium (PubChem CID 174103365) has the molecular formula C14H16F4N2O3S and a molecular weight of 368.35 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-[2-fluoro-5-nitro-3-(trifluoromethyl)phenyl]prop-2-enyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-[2-fluoro-5-nitro-3-(trifluoromethyl)phenyl]prop-2-enyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174103365 |
| Molecular Formula | C14H16F4N2O3S |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | tert-butyl-[[(1R)-1-[2-fluoro-5-nitro-3-(trifluoromethyl)phenyl]prop-2-enyl]amino]-oxidosulfanium |
| SMILES | C=C[C@@H](N[S+]([O-])C(C)(C)C)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H16F4N2O3S/c1-5-11(19-24(23)13(2,3)4)9-6-8(20(21)22)7-10(12(9)15)14(16,17)18/h5-7,11,19H,1H2,2-4H3/t11-,24?/m1/s1 |
| InChIKey | QYFLZDQYALRZSY-ZOLQVCMMSA-N |
| XLogP | 4.03 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|