C26H26BN3O — CID 174105190
CID 174105190 (PubChem CID 174105190) has the molecular formula C26H26BN3O and a molecular weight of 407.33 g/mol.
| Compound Name | CID 174105190 |
|---|---|
| PubChem CID | 174105190 |
| Molecular Formula | C26H26BN3O |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | — |
| SMILES | [B]C1(Cc2cccc(C#C)n2)CCN(C(=O)c2cccnc2C(/C=C\C)=C/C=C)CC1 |
| InChI | InChI=1S/C26H26BN3O/c1-4-9-20(10-5-2)24-23(13-8-16-28-24)25(31)30-17-14-26(27,15-18-30)19-22-12-7-11-21(6-3)29-22/h3-5,7-13,16H,1,14-15,17-19H2,2H3/b10-5-,20-9+ |
| InChIKey | BSDBSMIHKSNPSH-YPSDHDDDSA-N |
| XLogP | 4.41 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|