C18H18F3N5O — CID 174106919
3-[4-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyrazin-2-yl]piperidin-1-yl]prop-2-enal (PubChem CID 174106919) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-[4-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyrazin-2-yl]piperidin-1-yl]prop-2-enal.
| Compound Name | 3-[4-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyrazin-2-yl]piperidin-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 174106919 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-[4-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]pyrazin-2-yl]piperidin-1-yl]prop-2-enal |
| SMILES | O=CC=CN1CCC(c2nccnc2Nc2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C18H18F3N5O/c19-18(20,21)14-2-3-15(24-12-14)25-17-16(22-6-7-23-17)13-4-9-26(10-5-13)8-1-11-27/h1-3,6-8,11-13H,4-5,9-10H2,(H,23,24,25) |
| InChIKey | DFKFKVFGEZYCTJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|