C19H27F2NO — CID 174111834
(7R,8aS,9S)-3-(difluoromethoxy)-N-ethyl-N,7-dimethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-amine (PubChem CID 174111834) has the molecular formula C19H27F2NO and a molecular weight of 323.43 g/mol. Its IUPAC name is (7R,8aS,9S)-3-(difluoromethoxy)-N-ethyl-N,7-dimethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-amine.
| Compound Name | (7R,8aS,9S)-3-(difluoromethoxy)-N-ethyl-N,7-dimethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-amine |
|---|---|
| PubChem CID | 174111834 |
| Molecular Formula | C19H27F2NO |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (7R,8aS,9S)-3-(difluoromethoxy)-N-ethyl-N,7-dimethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-amine |
| SMILES | CCN(C)[C@H]1Cc2ccc(OC(F)F)cc2C2CC[C@@H](C)C[C@@H]21 |
| InChI | InChI=1S/C19H27F2NO/c1-4-22(3)18-10-13-6-7-14(23-19(20)21)11-16(13)15-8-5-12(2)9-17(15)18/h6-7,11-12,15,17-19H,4-5,8-10H2,1-3H3/t12-,15?,17+,18+/m1/s1 |
| InChIKey | VWZFGAAKGJVVSR-KLLLSUAQSA-N |
| XLogP | 4.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |