C18H24INO3 — CID 126539914
ethyl N-iodo-N-[(9S)-3-methoxy-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-yl]carbamate (PubChem CID 126539914) has the molecular formula C18H24INO3 and a molecular weight of 429.30 g/mol. Its IUPAC name is ethyl N-iodo-N-[(9S)-3-methoxy-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-yl]carbamate.
| Compound Name | ethyl N-iodo-N-[(9S)-3-methoxy-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-yl]carbamate |
|---|---|
| PubChem CID | 126539914 |
| Molecular Formula | C18H24INO3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | ethyl N-iodo-N-[(9S)-3-methoxy-4b,5,6,7,8,8a,9,10-octahydrophenanthren-9-yl]carbamate |
| SMILES | CCOC(=O)N(I)[C@H]1Cc2ccc(OC)cc2C2CCCCC21 |
| InChI | InChI=1S/C18H24INO3/c1-3-23-18(21)20(19)17-10-12-8-9-13(22-2)11-16(12)14-6-4-5-7-15(14)17/h8-9,11,14-15,17H,3-7,10H2,1-2H3/t14?,15?,17-/m0/s1 |
| InChIKey | AJFLSHZAMRMLMQ-DQPZFDDXSA-N |
| XLogP | 4.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|