C18H25B2NO — CID 174026640
CID 174026640 (PubChem CID 174026640) has the molecular formula C18H25B2NO and a molecular weight of 293.03 g/mol.
| Compound Name | CID 174026640 |
|---|---|
| PubChem CID | 174026640 |
| Molecular Formula | C18H25B2NO |
| Molecular Weight | 293.03 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])N(CC)[C@H]1Cc2ccc(OC)cc2C2CCCCC21 |
| InChI | InChI=1S/C18H25B2NO/c1-3-21(18(19)20)17-10-12-8-9-13(22-2)11-16(12)14-6-4-5-7-15(14)17/h8-9,11,14-15,17-18H,3-7,10H2,1-2H3/t14?,15?,17-/m0/s1 |
| InChIKey | LGWCPSPROVHJOX-DQPZFDDXSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|