C24H14B3Cl2F3N4O3 — CID 174112655
CID 174112655 (PubChem CID 174112655) has the molecular formula C24H14B3Cl2F3N4O3 and a molecular weight of 566.74 g/mol.
| Compound Name | CID 174112655 |
|---|---|
| PubChem CID | 174112655 |
| Molecular Formula | C24H14B3Cl2F3N4O3 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1nc2c(C)ccc(NC(=O)c3cc(Cl)c(O)c(Cl)n3)c2c(=O)n1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H14B3Cl2F3N4O3/c1-10-6-7-14(34-20(38)15-8-13(28)18(37)19(29)33-15)16-17(10)35-22(23(25,26)27)36(21(16)39)9-11-4-2-3-5-12(11)24(30,31)32/h2-8,37H,9H2,1H3,(H,34,38) |
| InChIKey | JEIFCHRPRTUOSU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|