C23H11B3Cl2F4N4O3 — CID 174112658
CID 174112658 (PubChem CID 174112658) has the molecular formula C23H11B3Cl2F4N4O3 and a molecular weight of 570.70 g/mol.
| Compound Name | CID 174112658 |
|---|---|
| PubChem CID | 174112658 |
| Molecular Formula | C23H11B3Cl2F4N4O3 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1nc2c(F)ccc(NC(=O)c3cc(Cl)c(O)c(Cl)n3)c2c(=O)n1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H11B3Cl2F4N4O3/c24-22(25,26)21-35-16-12(29)5-6-13(34-19(38)14-7-11(27)17(37)18(28)33-14)15(16)20(39)36(21)8-9-3-1-2-4-10(9)23(30,31)32/h1-7,37H,8H2,(H,34,38) |
| InChIKey | JMBRKXBHZIVMFZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|