C21H15Cl2F4N5O3 — CID 169110154
N-[3-amino-2-[amino-[[2-(trifluoromethyl)phenyl]methyl]carbamoyl]-4-fluorophenyl]-4,6-dichloro-5-hydroxypyridine-2-carboxamide (PubChem CID 169110154) has the molecular formula C21H15Cl2F4N5O3 and a molecular weight of 532.28 g/mol. Its IUPAC name is N-[3-amino-2-[amino-[[2-(trifluoromethyl)phenyl]methyl]carbamoyl]-4-fluorophenyl]-4,6-dichloro-5-hydroxypyridine-2-carboxamide.
| Compound Name | N-[3-amino-2-[amino-[[2-(trifluoromethyl)phenyl]methyl]carbamoyl]-4-fluorophenyl]-4,6-dichloro-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 169110154 |
| Molecular Formula | C21H15Cl2F4N5O3 |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | N-[3-amino-2-[amino-[[2-(trifluoromethyl)phenyl]methyl]carbamoyl]-4-fluorophenyl]-4,6-dichloro-5-hydroxypyridine-2-carboxamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2cc(Cl)c(O)c(Cl)n2)c1C(=O)N(N)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H15Cl2F4N5O3/c22-11-7-14(30-18(23)17(11)33)19(34)31-13-6-5-12(24)16(28)15(13)20(35)32(29)8-9-3-1-2-4-10(9)21(25,26)27/h1-7,33H,8,28-29H2,(H,31,34) |
| InChIKey | BDWHHAURNDSPKK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|