C14H15NO2 — CID 174116959
1-(4-ethyl-2,6-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 174116959) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-(4-ethyl-2,6-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-ethyl-2,6-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174116959 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-(4-ethyl-2,6-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | CCc1cc(C)c(N2C(=O)C=CC2=O)c(C)c1 |
| InChI | InChI=1S/C14H15NO2/c1-4-11-7-9(2)14(10(3)8-11)15-12(16)5-6-13(15)17/h5-8H,4H2,1-3H3 |
| InChIKey | OQZIEZREGVNBOX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|