C21H25FN4O3 — CID 174121383
5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-6-(4-propan-2-ylpiperazin-1-yl)isoindole-1,3-dione (PubChem CID 174121383) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-6-(4-propan-2-ylpiperazin-1-yl)isoindole-1,3-dione.
| Compound Name | 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-6-(4-propan-2-ylpiperazin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 174121383 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-fluoro-2-(6-methylidene-2-oxopiperidin-3-yl)-6-(4-propan-2-ylpiperazin-1-yl)isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3cc(F)c(N4CCN(C(C)C)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25FN4O3/c1-12(2)24-6-8-25(9-7-24)18-11-15-14(10-16(18)22)20(28)26(21(15)29)17-5-4-13(3)23-19(17)27/h10-12,17H,3-9H2,1-2H3,(H,23,27) |
| InChIKey | VOPUXJADQRZFNQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|