C26H55B3O9 — CID 174134115
3-methyl-3-[[4-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]oxy-6-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]oxy-1,3,5,2,4,6-trioxatriborinan-2-yl]oxy]butan-1-ol (PubChem CID 174134115) has the molecular formula C26H55B3O9 and a molecular weight of 544.15 g/mol. Its IUPAC name is 3-methyl-3-[[4-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]oxy-6-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]oxy-1,3,5,2,4,6-trioxatriborinan-2-yl]oxy]butan-1-ol.
| Compound Name | 3-methyl-3-[[4-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]oxy-6-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]oxy-1,3,5,2,4,6-trioxatriborinan-2-yl]oxy]butan-1-ol |
|---|---|
| PubChem CID | 174134115 |
| Molecular Formula | C26H55B3O9 |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | 3-methyl-3-[[4-[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl]oxy-6-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]oxy-1,3,5,2,4,6-trioxatriborinan-2-yl]oxy]butan-1-ol |
| SMILES | CCCC(C)(C)OCCC(C)(C)OB1OB(OC(C)(C)CCO)OB(OC(C)(C)CCOC(C)(C)CC)O1 |
| InChI | InChI=1S/C26H55B3O9/c1-13-15-23(5,6)32-21-18-26(11,12)35-29-37-27(33-24(7,8)16-19-30)36-28(38-29)34-25(9,10)17-20-31-22(3,4)14-2/h30H,13-21H2,1-12H3 |
| InChIKey | DNDYLROYISQGBZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|