C16H26O3S2 — CID 174146704
3-[(4-ethenyl-9-tricyclo[6.2.1.02,7]undecanyl)sulfanyl]propane-1-sulfonic acid (PubChem CID 174146704) has the molecular formula C16H26O3S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 3-[(4-ethenyl-9-tricyclo[6.2.1.02,7]undecanyl)sulfanyl]propane-1-sulfonic acid.
| Compound Name | 3-[(4-ethenyl-9-tricyclo[6.2.1.02,7]undecanyl)sulfanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174146704 |
| Molecular Formula | C16H26O3S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[(4-ethenyl-9-tricyclo[6.2.1.02,7]undecanyl)sulfanyl]propane-1-sulfonic acid |
| SMILES | C=CC1CCC2C(C1)C1CC(SCCCS(=O)(=O)O)C2C1 |
| InChI | InChI=1S/C16H26O3S2/c1-2-11-4-5-13-14(8-11)12-9-15(13)16(10-12)20-6-3-7-21(17,18)19/h2,11-16H,1,3-10H2,(H,17,18,19) |
| InChIKey | YCZYLJROSLAQLE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|