C18H28S — CID 170373483
(1S,3R,4S,6R,8S,9S)-4-butylsulfanyl-9-ethenyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 170373483) has the molecular formula C18H28S and a molecular weight of 276.49 g/mol. Its IUPAC name is (1S,3R,4S,6R,8S,9S)-4-butylsulfanyl-9-ethenyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | (1S,3R,4S,6R,8S,9S)-4-butylsulfanyl-9-ethenyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 170373483 |
| Molecular Formula | C18H28S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (1S,3R,4S,6R,8S,9S)-4-butylsulfanyl-9-ethenyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | C=C[C@@H]1CC2C[C@@H]1C1C3C[C@H](SCCCC)[C@H](C3)C21 |
| InChI | InChI=1S/C18H28S/c1-3-5-6-19-16-10-13-9-15(16)18-12-7-11(4-2)14(8-12)17(13)18/h4,11-18H,2-3,5-10H2,1H3/t11-,12?,13?,14+,15+,16+,17?,18?/m1/s1 |
| InChIKey | DOWQDBIETQFYTC-USVGFELUSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|