C21H38S — CID 154691914
10-butylsulfanyl-4-(4-methylpentan-2-yl)tricyclo[6.2.1.02,7]undecane (PubChem CID 154691914) has the molecular formula C21H38S and a molecular weight of 322.60 g/mol. Its IUPAC name is 10-butylsulfanyl-4-(4-methylpentan-2-yl)tricyclo[6.2.1.02,7]undecane.
| Compound Name | 10-butylsulfanyl-4-(4-methylpentan-2-yl)tricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 154691914 |
| Molecular Formula | C21H38S |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 10-butylsulfanyl-4-(4-methylpentan-2-yl)tricyclo[6.2.1.02,7]undecane |
| SMILES | CCCCSC1CC2CC1C1CC(C(C)CC(C)C)CCC21 |
| InChI | InChI=1S/C21H38S/c1-5-6-9-22-21-13-17-12-20(21)19-11-16(7-8-18(17)19)15(4)10-14(2)3/h14-21H,5-13H2,1-4H3 |
| InChIKey | DKQOAFBACNIRLD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|