C14H26S — CID 143123666
5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane (PubChem CID 143123666) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane.
| Compound Name | 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 143123666 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane |
| SMILES | CCCCSC1CC2CC1C(C)C2CC |
| InChI | InChI=1S/C14H26S/c1-4-6-7-15-14-9-11-8-13(14)10(3)12(11)5-2/h10-14H,4-9H2,1-3H3 |
| InChIKey | FXKGBPUUHIHHMK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|