C18H38S — CID 143123665
5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane;ethane (PubChem CID 143123665) has the molecular formula C18H38S and a molecular weight of 286.57 g/mol. Its IUPAC name is 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane;ethane.
| Compound Name | 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane;ethane |
|---|---|
| PubChem CID | 143123665 |
| Molecular Formula | C18H38S |
| Molecular Weight | 286.57 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 5-butylsulfanyl-2-ethyl-3-methylbicyclo[2.2.1]heptane;ethane |
| SMILES | CC.CC.CCCCSC1CC2CC1C(C)C2CC |
| InChI | InChI=1S/C14H26S.2C2H6/c1-4-6-7-15-14-9-11-8-13(14)10(3)12(11)5-2;2*1-2/h10-14H,4-9H2,1-3H3;2*1-2H3 |
| InChIKey | RXJUGIZVJBUCML-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|