C19H28OS2 — CID 59745362
S-(4-ethylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl) ethanethioate (PubChem CID 59745362) has the molecular formula C19H28OS2 and a molecular weight of 336.57 g/mol. Its IUPAC name is S-(4-ethylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl) ethanethioate.
| Compound Name | S-(4-ethylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl) ethanethioate |
|---|---|
| PubChem CID | 59745362 |
| Molecular Formula | C19H28OS2 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | S-(4-ethylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl) ethanethioate |
| SMILES | CCSC1CC2CC1C1C3CC(C4CC(SC(C)=O)CC43)C21 |
| InChI | InChI=1S/C19H28OS2/c1-3-21-17-5-10-4-16(17)19-15-8-14(18(10)19)12-6-11(7-13(12)15)22-9(2)20/h10-19H,3-8H2,1-2H3 |
| InChIKey | SZKRZADMIGWDNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|