C42H60O4S4 — CID 59745367
[6-[(11-acetylsulfanyl-4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]-4-oxohexyl] 3-[(4-methylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]propanoate (PubChem CID 59745367) has the molecular formula C42H60O4S4 and a molecular weight of 757.21 g/mol. Its IUPAC name is [6-[(11-acetylsulfanyl-4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]-4-oxohexyl] 3-[(4-methylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]propanoate.
| Compound Name | [6-[(11-acetylsulfanyl-4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]-4-oxohexyl] 3-[(4-methylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 59745367 |
| Molecular Formula | C42H60O4S4 |
| Molecular Weight | 757.21 g/mol |
| Exact Mass | 756.34 |
| IUPAC Name | [6-[(11-acetylsulfanyl-4-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]-4-oxohexyl] 3-[(4-methylsulfanyl-11-pentacyclo[6.5.1.13,6.02,7.09,13]pentadecanyl)sulfanyl]propanoate |
| SMILES | CSC1CC2CC1C1C3CC(C4CC(SCCC(=O)OCCCC(=O)CCSC5CC6CC5C5C7CC(C8CC(SC(C)=O)CC87)C65)CC43)C21 |
| InChI | InChI=1S/C42H60O4S4/c1-20(43)50-25-16-28-29(17-25)33-19-31(28)40-22-11-35(42(33)40)37(13-22)49-8-5-23(44)4-3-7-46-38(45)6-9-48-24-14-26-27(15-24)32-18-30(26)39-21-10-34(41(32)39)36(12-21)47-2/h21-22,24-37,39-42H,3-19H2,1-2H3 |
| InChIKey | TZZZWQMOYCIYIL-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.21 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|