C16H22O2S — CID 101010236
2-(8-tricyclo[5.2.1.02,6]dec-4-enylsulfanyl)ethyl 2-methylprop-2-enoate (PubChem CID 101010236) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-(8-tricyclo[5.2.1.02,6]dec-4-enylsulfanyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(8-tricyclo[5.2.1.02,6]dec-4-enylsulfanyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101010236 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(8-tricyclo[5.2.1.02,6]dec-4-enylsulfanyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSC1CC2CC1C1C=CCC21 |
| InChI | InChI=1S/C16H22O2S/c1-10(2)16(17)18-6-7-19-15-9-11-8-14(15)13-5-3-4-12(11)13/h3,5,11-15H,1,4,6-9H2,2H3 |
| InChIKey | FVKSKIFWMRYBBS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|