C14H22O2 — CID 97298808
(1S,2S,6S,7S)-9,9-diethoxytricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 97298808) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S,2S,6S,7S)-9,9-diethoxytricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1S,2S,6S,7S)-9,9-diethoxytricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 97298808 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1S,2S,6S,7S)-9,9-diethoxytricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | CCOC1(OCC)C[C@@H]2C[C@H]1[C@H]1C=CC[C@@H]21 |
| InChI | InChI=1S/C14H22O2/c1-3-15-14(16-4-2)9-10-8-13(14)12-7-5-6-11(10)12/h5,7,10-13H,3-4,6,8-9H2,1-2H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | XPTYNVVWIOVRPP-CYDGBPFRSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|