C26H44O6 — CID 174148053
2-[(2R,5S,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,5-dimethyloxan-2-yl]acetic acid (PubChem CID 174148053) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is 2-[(2R,5S,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,5-dimethyloxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,5S,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,5-dimethyloxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 174148053 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-[(2R,5S,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4,5-dimethyloxan-2-yl]acetic acid |
| SMILES | CO[C@H]([C@@H](C)[C@H]1O[C@]1(C)C[C@H](C)/C=C/C=C(\C)[C@H]1O[C@@H](CC(=O)O)CC(C)[C@@H]1C)[C@@H](C)O |
| InChI | InChI=1S/C26H44O6/c1-15(14-26(7)25(32-26)19(5)24(30-8)20(6)27)10-9-11-16(2)23-18(4)17(3)12-21(31-23)13-22(28)29/h9-11,15,17-21,23-25,27H,12-14H2,1-8H3,(H,28,29)/b10-9+,16-11+/t15-,17?,18+,19-,20-,21-,23-,24-,25-,26-/m1/s1 |
| InChIKey | BYMCHXQKIIOWPP-CGRZAUKKSA-N |
| XLogP | 4.61 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|