C26H42O7 — CID 154588756
methyl 2-[(2R,3S,6S)-2-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methoxy-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 154588756) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is methyl 2-[(2R,3S,6S)-2-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methoxy-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,6S)-2-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methoxy-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 154588756 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | methyl 2-[(2R,3S,6S)-2-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methoxy-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@H](OC)[C@@H](/C(C)=C/C=C/[C@@H](C)C[C@@]2(C)O[C@@H]2[C@H](C)C(OC)[C@@H](C)O)O1 |
| InChI | InChI=1S/C26H42O7/c1-16(15-26(5)25(33-26)18(3)24(31-8)19(4)27)10-9-11-17(2)23-21(29-6)13-12-20(32-23)14-22(28)30-7/h9-13,16,18-21,23-25,27H,14-15H2,1-8H3/b10-9+,17-11+/t16-,18-,19-,20-,21+,23-,24?,25-,26-/m1/s1 |
| InChIKey | VLXDBXOEYQQLST-VBIFGNLASA-N |
| XLogP | 3.61 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|