C26H42O6 — CID 147459743
methyl 2-[(2S,3R,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-3,6-dihydro-2H-pyran-2-yl]acetate (PubChem CID 147459743) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is methyl 2-[(2S,3R,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-3,6-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-3,6-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 147459743 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | methyl 2-[(2S,3R,6S)-6-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3R,4R)-4-hydroxy-3-methoxypentan-2-yl]-2-methyloxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3-methyl-3,6-dihydro-2H-pyran-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](/C(C)=C/C=C/[C@@H](C)C[C@@]2(C)O[C@@H]2[C@H](C)[C@@H](OC)[C@@H](C)O)C=C[C@H]1C |
| InChI | InChI=1S/C26H42O6/c1-16(15-26(6)25(32-26)19(4)24(30-8)20(5)27)10-9-11-17(2)21-13-12-18(3)22(31-21)14-23(28)29-7/h9-13,16,18-22,24-25,27H,14-15H2,1-8H3/b10-9+,17-11+/t16-,18-,19-,20-,21+,22+,24-,25-,26-/m1/s1 |
| InChIKey | DZRULZQLXKCMBY-ZOXRZWEUSA-N |
| XLogP | 4.23 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|