C14H14N4O3S — CID 174151523
N-(6-formyl-1,3-benzothiazol-2-yl)-2-(2-oxopiperazin-1-yl)acetamide (PubChem CID 174151523) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-(6-formyl-1,3-benzothiazol-2-yl)-2-(2-oxopiperazin-1-yl)acetamide.
| Compound Name | N-(6-formyl-1,3-benzothiazol-2-yl)-2-(2-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 174151523 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(6-formyl-1,3-benzothiazol-2-yl)-2-(2-oxopiperazin-1-yl)acetamide |
| SMILES | O=Cc1ccc2nc(NC(=O)CN3CCNCC3=O)sc2c1 |
| InChI | InChI=1S/C14H14N4O3S/c19-8-9-1-2-10-11(5-9)22-14(16-10)17-12(20)7-18-4-3-15-6-13(18)21/h1-2,5,8,15H,3-4,6-7H2,(H,16,17,20) |
| InChIKey | NECDUFIEQNRKMY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|