C11H22N2O4 — CID 174154670
(3R,4R,5R)-6-(aminomethyl)-3-piperidin-1-yloxane-2,4,5-triol (PubChem CID 174154670) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R,4R,5R)-6-(aminomethyl)-3-piperidin-1-yloxane-2,4,5-triol.
| Compound Name | (3R,4R,5R)-6-(aminomethyl)-3-piperidin-1-yloxane-2,4,5-triol |
|---|---|
| PubChem CID | 174154670 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3R,4R,5R)-6-(aminomethyl)-3-piperidin-1-yloxane-2,4,5-triol |
| SMILES | NCC1OC(O)[C@H](N2CCCCC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22N2O4/c12-6-7-9(14)10(15)8(11(16)17-7)13-4-2-1-3-5-13/h7-11,14-16H,1-6,12H2/t7?,8-,9+,10-,11?/m1/s1 |
| InChIKey | KYRJHYYCVIZBQN-BAUKGFNRSA-N |
| XLogP | -1.76 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |