C10H15F3N2O4 — CID 166975572
1-[(3aS,7aS)-5-(aminomethyl)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2,2,2-trifluoroethanone (PubChem CID 166975572) has the molecular formula C10H15F3N2O4 and a molecular weight of 284.23 g/mol. Its IUPAC name is 1-[(3aS,7aS)-5-(aminomethyl)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3aS,7aS)-5-(aminomethyl)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 166975572 |
| Molecular Formula | C10H15F3N2O4 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[(3aS,7aS)-5-(aminomethyl)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2,2,2-trifluoroethanone |
| SMILES | NCC1O[C@H]2CCN(C(=O)C(F)(F)F)[C@H]2C(O)C1O |
| InChI | InChI=1S/C10H15F3N2O4/c11-10(12,13)9(18)15-2-1-4-6(15)8(17)7(16)5(3-14)19-4/h4-8,16-17H,1-3,14H2/t4-,5?,6+,7?,8?/m0/s1 |
| InChIKey | QMPHEERVNFFYGU-GRONODGRSA-N |
| XLogP | -1.40 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |