C14H21F3N2O5 — CID 167524404
1-[(1S,2R,6S,7R,9R)-7-(aminomethyl)-4,4,11-trimethyl-3,5,8,10-tetraoxa-13-azatricyclo[7.4.0.02,6]tridecan-13-yl]-2,2,2-trifluoroethanone (PubChem CID 167524404) has the molecular formula C14H21F3N2O5 and a molecular weight of 354.33 g/mol. Its IUPAC name is 1-[(1S,2R,6S,7R,9R)-7-(aminomethyl)-4,4,11-trimethyl-3,5,8,10-tetraoxa-13-azatricyclo[7.4.0.02,6]tridecan-13-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1S,2R,6S,7R,9R)-7-(aminomethyl)-4,4,11-trimethyl-3,5,8,10-tetraoxa-13-azatricyclo[7.4.0.02,6]tridecan-13-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 167524404 |
| Molecular Formula | C14H21F3N2O5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[(1S,2R,6S,7R,9R)-7-(aminomethyl)-4,4,11-trimethyl-3,5,8,10-tetraoxa-13-azatricyclo[7.4.0.02,6]tridecan-13-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1CN(C(=O)C(F)(F)F)[C@@H]2[C@H](O1)O[C@H](CN)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H21F3N2O5/c1-6-5-19(12(20)14(15,16)17)8-10-9(23-13(2,3)24-10)7(4-18)22-11(8)21-6/h6-11H,4-5,18H2,1-3H3/t6?,7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | WBFLJBBAOAGLQG-VICZIMABSA-N |
| XLogP | 0.37 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |