C30H31NO6S — CID 174154781
3-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 174154781) has the molecular formula C30H31NO6S and a molecular weight of 533.65 g/mol. Its IUPAC name is 3-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 174154781 |
| Molecular Formula | C30H31NO6S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 3-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1[C@@H]1CO[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H31NO6S/c32-27-21-38-30(33)31(27)25-19-35-26(20-34-16-22-10-4-1-5-11-22)29(37-18-24-14-8-3-9-15-24)28(25)36-17-23-12-6-2-7-13-23/h1-15,25-26,28-29H,16-21H2/t25-,26-,28-,29+/m1/s1 |
| InChIKey | OOCOZLMLXZXXKS-HTCHUFIESA-N |
| XLogP | 4.84 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|