About dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite
dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite (PubChem CID 174156089) has the molecular formula AuO6S3-4
and a molecular weight of 389.16 g/mol. Its IUPAC name is dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite.
Molecular Properties
| Compound Name | dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite |
| PubChem CID | 174156089 |
| Molecular Formula | AuO6S3-4 |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 388.85 |
| IUPAC Name | dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite |
| SMILES | O=S([O-])([O-])=S.O=S([O-])[O-].[Au] |
| InChI | InChI=1S/Au.H2O3S2.H2O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);(H2,1,2,3)/p-4 |
| InChIKey | XKOCFNXOZVUNRR-UHFFFAOYSA-J |
| XLogP | -2.01 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite?
The IUPAC name of dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite (CID 174156089) is dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite.
What is the SMILES notation for dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite?
The canonical SMILES for dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite is O=S([O-])([O-])=S.O=S([O-])[O-].[Au].
What is the InChIKey of dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite?
The InChIKey is XKOCFNXOZVUNRR-UHFFFAOYSA-J. The full InChI is InChI=1S/Au.H2O3S2.H2O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);(H2,1,2,3)/p-4.
What are the key properties of dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite?
dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite has a molecular weight of 389.16 g/mol, XLogP of -2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite is sourced from PubChem (CID 174156089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).