AuO6S3-4 — CID 174156089
dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite (PubChem CID 174156089) has the molecular formula AuO6S3-4 and a molecular weight of 389.16 g/mol. Its IUPAC name is dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite.
| Compound Name | dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite |
|---|---|
| PubChem CID | 174156089 |
| Molecular Formula | AuO6S3-4 |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 388.85 |
| IUPAC Name | dioxido-oxo-sulfanylidene-λ6-sulfane;gold;sulfite |
| SMILES | O=S([O-])([O-])=S.O=S([O-])[O-].[Au] |
| InChI | InChI=1S/Au.H2O3S2.H2O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);(H2,1,2,3)/p-4 |
| InChIKey | XKOCFNXOZVUNRR-UHFFFAOYSA-J |
| XLogP | -2.01 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|