C17H32BN3O5 — CID 174156571
(2S,3R)-2-[[(3aS,4R,6aR)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-4-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 174156571) has the molecular formula C17H32BN3O5 and a molecular weight of 369.27 g/mol. Its IUPAC name is (2S,3R)-2-[[(3aS,4R,6aR)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-4-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[[(3aS,4R,6aR)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-4-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 174156571 |
| Molecular Formula | C17H32BN3O5 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (2S,3R)-2-[[(3aS,4R,6aR)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-4-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)[C@]1(CCCCB(O)O)NC[C@@H]2NCC[C@@H]21)C(=O)O |
| InChI | InChI=1S/C17H32BN3O5/c1-3-11(2)14(15(22)23)21-16(24)17(7-4-5-8-18(25)26)12-6-9-19-13(12)10-20-17/h11-14,19-20,25-26H,3-10H2,1-2H3,(H,21,24)(H,22,23)/t11-,12+,13+,14+,17-/m1/s1 |
| InChIKey | CHOSZRPDKQKDRE-PYXYIPKBSA-N |
| XLogP | -0.43 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|