C17H32BN3O4 — CID 170612296
4-[(3aS,4R,6aR)-4-(piperidin-4-ylmethoxycarbonyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid (PubChem CID 170612296) has the molecular formula C17H32BN3O4 and a molecular weight of 353.27 g/mol. Its IUPAC name is 4-[(3aS,4R,6aR)-4-(piperidin-4-ylmethoxycarbonyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid.
| Compound Name | 4-[(3aS,4R,6aR)-4-(piperidin-4-ylmethoxycarbonyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid |
|---|---|
| PubChem CID | 170612296 |
| Molecular Formula | C17H32BN3O4 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-[(3aS,4R,6aR)-4-(piperidin-4-ylmethoxycarbonyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid |
| SMILES | O=C(OCC1CCNCC1)[C@]1(CCCCB(O)O)NC[C@@H]2NCC[C@@H]21 |
| InChI | InChI=1S/C17H32BN3O4/c22-16(25-12-13-3-8-19-9-4-13)17(6-1-2-7-18(23)24)14-5-10-20-15(14)11-21-17/h13-15,19-21,23-24H,1-12H2/t14-,15-,17+/m0/s1 |
| InChIKey | KUQQODJTVFZTRA-YQQAZPJKSA-N |
| XLogP | -0.51 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|