C17H32BN3O5 — CID 174156582
(3aS,4R,6aR)-1-[(2S,3S)-2-amino-3-methylpentanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid (PubChem CID 174156582) has the molecular formula C17H32BN3O5 and a molecular weight of 369.27 g/mol. Its IUPAC name is (3aS,4R,6aR)-1-[(2S,3S)-2-amino-3-methylpentanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid.
| Compound Name | (3aS,4R,6aR)-1-[(2S,3S)-2-amino-3-methylpentanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 174156582 |
| Molecular Formula | C17H32BN3O5 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (3aS,4R,6aR)-1-[(2S,3S)-2-amino-3-methylpentanoyl]-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1CC[C@H]2[C@@H]1CN[C@@]2(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C17H32BN3O5/c1-3-11(2)14(19)15(22)21-9-6-12-13(21)10-20-17(12,16(23)24)7-4-5-8-18(25)26/h11-14,20,25-26H,3-10,19H2,1-2H3,(H,23,24)/t11-,12-,13-,14-,17+/m0/s1 |
| InChIKey | ACAMEYDMBXXMJT-GGOFEBJYSA-N |
| XLogP | -0.35 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|