C16H28BN3O8 — CID 174156613
(3aS,4R,6aR)-1-(2-aminopropanoyloxymethoxycarbonyl)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid (PubChem CID 174156613) has the molecular formula C16H28BN3O8 and a molecular weight of 401.23 g/mol. Its IUPAC name is (3aS,4R,6aR)-1-(2-aminopropanoyloxymethoxycarbonyl)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid.
| Compound Name | (3aS,4R,6aR)-1-(2-aminopropanoyloxymethoxycarbonyl)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 174156613 |
| Molecular Formula | C16H28BN3O8 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (3aS,4R,6aR)-1-(2-aminopropanoyloxymethoxycarbonyl)-4-(4-boronobutyl)-2,3,3a,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole-4-carboxylic acid |
| SMILES | CC(N)C(=O)OCOC(=O)N1CC[C@H]2[C@@H]1CN[C@@]2(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C16H28BN3O8/c1-10(18)13(21)27-9-28-15(24)20-7-4-11-12(20)8-19-16(11,14(22)23)5-2-3-6-17(25)26/h10-12,19,25-26H,2-9,18H2,1H3,(H,22,23)/t10?,11-,12-,16+/m0/s1 |
| InChIKey | ZDTMNWZCCOFMFL-LICYYNRDSA-N |
| XLogP | -1.27 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|