C12H24BN3O5 — CID 175463747
1-[[(2S)-2-aminopropanoyl]amino]-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid (PubChem CID 175463747) has the molecular formula C12H24BN3O5 and a molecular weight of 301.15 g/mol. Its IUPAC name is 1-[[(2S)-2-aminopropanoyl]amino]-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[(2S)-2-aminopropanoyl]amino]-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175463747 |
| Molecular Formula | C12H24BN3O5 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-[[(2S)-2-aminopropanoyl]amino]-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N)C(=O)NN1CCCC1(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C12H24BN3O5/c1-9(14)10(17)15-16-8-4-6-12(16,11(18)19)5-2-3-7-13(20)21/h9,20-21H,2-8,14H2,1H3,(H,15,17)(H,18,19)/t9-,12?/m0/s1 |
| InChIKey | OWKFZGDHTDRMET-QHGLUPRGSA-N |
| XLogP | -1.07 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|