C18H33BN2O6 — CID 170612282
4-[(3aS,4R,6aR)-4-[2-(2,2-dimethylpropanoyloxy)ethoxycarbonyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid (PubChem CID 170612282) has the molecular formula C18H33BN2O6 and a molecular weight of 384.28 g/mol. Its IUPAC name is 4-[(3aS,4R,6aR)-4-[2-(2,2-dimethylpropanoyloxy)ethoxycarbonyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid.
| Compound Name | 4-[(3aS,4R,6aR)-4-[2-(2,2-dimethylpropanoyloxy)ethoxycarbonyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid |
|---|---|
| PubChem CID | 170612282 |
| Molecular Formula | C18H33BN2O6 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 4-[(3aS,4R,6aR)-4-[2-(2,2-dimethylpropanoyloxy)ethoxycarbonyl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-4-yl]butylboronic acid |
| SMILES | CC(C)(C)C(=O)OCCOC(=O)[C@]1(CCCCB(O)O)NC[C@@H]2NCC[C@@H]21 |
| InChI | InChI=1S/C18H33BN2O6/c1-17(2,3)15(22)26-10-11-27-16(23)18(7-4-5-8-19(24)25)13-6-9-20-14(13)12-21-18/h13-14,20-21,24-25H,4-12H2,1-3H3/t13-,14-,18+/m0/s1 |
| InChIKey | IBVQOAMTPNHBLY-SUNYJGFJSA-N |
| XLogP | 0.08 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|