(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid

C13H14N4O2 — CID 174158343

IUPAC(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid
SMILESCc1cc2n(n1)-c1cccc(NC(=O)O)c1N(C)C2
InChIInChI=1S/C13H14N4O2/c1-8-6-9-7-16(2)12-10(14-13(18)19)4-3-5-11(12)17(9)15-8/h3-6,14H,7H2,1-2H3,(H,18,19)
InChIKeyGNIKBJILAZIAQK-UHFFFAOYSA-N
MW258.28 g/mol
LogP2.22
Rot. Bonds1

About (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid

(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid (PubChem CID 174158343) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid.

Molecular Properties

Compound Name(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid
PubChem CID174158343
Molecular FormulaC13H14N4O2
Molecular Weight258.28 g/mol
Exact Mass258.11
IUPAC Name(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid
SMILESCc1cc2n(n1)-c1cccc(NC(=O)O)c1N(C)C2
InChIInChI=1S/C13H14N4O2/c1-8-6-9-7-16(2)12-10(14-13(18)19)4-3-5-11(12)17(9)15-8/h3-6,14H,7H2,1-2H3,(H,18,19)
InChIKeyGNIKBJILAZIAQK-UHFFFAOYSA-N
XLogP2.22
TPSA70.39 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid?
The IUPAC name of (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid (CID 174158343) is (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid.
What is the SMILES notation for (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid?
The canonical SMILES for (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid is Cc1cc2n(n1)-c1cccc(NC(=O)O)c1N(C)C2.
What is the InChIKey of (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid?
The InChIKey is GNIKBJILAZIAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2/c1-8-6-9-7-16(2)12-10(14-13(18)19)4-3-5-11(12)17(9)15-8/h3-6,14H,7H2,1-2H3,(H,18,19).
What are the key properties of (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid?
(2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid has a molecular weight of 258.28 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-4H-pyrazolo[1,5-a]quinoxalin-6-yl)carbamic acid is sourced from PubChem (CID 174158343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).